C9H17O+ — CID 163435891
(4-propan-2-ylcyclohexen-1-yl)oxidanium (PubChem CID 163435891) has the molecular formula C9H17O+ and a molecular weight of 141.23 g/mol. Its IUPAC name is (4-propan-2-ylcyclohexen-1-yl)oxidanium.
| Compound Name | (4-propan-2-ylcyclohexen-1-yl)oxidanium |
|---|---|
| PubChem CID | 163435891 |
| Molecular Formula | C9H17O+ |
| Molecular Weight | 141.23 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | (4-propan-2-ylcyclohexen-1-yl)oxidanium |
| SMILES | CC(C)C1CC=C([OH2+])CC1 |
| InChI | InChI=1S/C9H16O/c1-7(2)8-3-5-9(10)6-4-8/h5,7-8,10H,3-4,6H2,1-2H3/p+1 |
| InChIKey | AULRHYBGVDPBNJ-UHFFFAOYSA-O |
| XLogP | 2.05 |
| TPSA | 22.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|