C7H6 — CID 163566431
tricyclo[2.2.1.01,3]hepta-3,5-diene (PubChem CID 163566431) has the molecular formula C7H6 and a molecular weight of 90.12 g/mol. Its IUPAC name is tricyclo[2.2.1.01,3]hepta-3,5-diene.
| Compound Name | tricyclo[2.2.1.01,3]hepta-3,5-diene |
|---|---|
| PubChem CID | 163566431 |
| Molecular Formula | C7H6 |
| Molecular Weight | 90.12 g/mol |
| Exact Mass | 90.05 |
| IUPAC Name | tricyclo[2.2.1.01,3]hepta-3,5-diene |
| SMILES | C1=CC23CC1=C2C3 |
| InChI | InChI=1S/C7H6/c1-2-7-3-5(1)6(7)4-7/h1-2H,3-4H2 |
| InChIKey | FVPGMMQBPLNHLS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 90.12 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |