About 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one
7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one (PubChem CID 143902117) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one |
| PubChem CID | 143902117 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one |
| SMILES | CNC1=CC2=C(CC1)NC(=O)CO2 |
| InChI | InChI=1S/C9H12N2O2/c1-10-6-2-3-7-8(4-6)13-5-9(12)11-7/h4,10H,2-3,5H2,1H3,(H,11,12) |
| InChIKey | IEAFVKATSOBGTJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one?
The IUPAC name of 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one (CID 143902117) is 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one is CNC1=CC2=C(CC1)NC(=O)CO2.
What is the InChIKey of 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one?
The InChIKey is IEAFVKATSOBGTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-10-6-2-3-7-8(4-6)13-5-9(12)11-7/h4,10H,2-3,5H2,1H3,(H,11,12).
What are the key properties of 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one?
7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one has a molecular weight of 180.21 g/mol, XLogP of 0.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 143902117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).