C9H12N2O2 — CID 143902117
7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one (PubChem CID 143902117) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 143902117 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 7-(methylamino)-5,6-dihydro-4H-1,4-benzoxazin-3-one |
| SMILES | CNC1=CC2=C(CC1)NC(=O)CO2 |
| InChI | InChI=1S/C9H12N2O2/c1-10-6-2-3-7-8(4-6)13-5-9(12)11-7/h4,10H,2-3,5H2,1H3,(H,11,12) |
| InChIKey | IEAFVKATSOBGTJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |