C16H15 — CID 143958487
CID 143958487 (PubChem CID 143958487) has the molecular formula C16H15 and a molecular weight of 207.30 g/mol.
| Compound Name | CID 143958487 |
|---|---|
| PubChem CID | 143958487 |
| Molecular Formula | C16H15 |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | — |
| SMILES | CC1=CC=C(C2=CC=C(C3=C=[C]3)CC2)CC1 |
| InChI | InChI=1S/C16H15/c1-12-2-4-13(5-3-12)14-6-8-15(9-7-14)16-10-11-16/h2,4,6,8H,3,5,7,9H2,1H3 |
| InChIKey | NYOANCXZGHFLKN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |