C25H31P — CID 144737043
[4-[(2E,4E)-5-[4-(4-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]hexa-2,4-dien-2-yl]cyclohexa-1,3-dien-1-yl]phosphane (PubChem CID 144737043) has the molecular formula C25H31P and a molecular weight of 362.50 g/mol. Its IUPAC name is [4-[(2E,4E)-5-[4-(4-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]hexa-2,4-dien-2-yl]cyclohexa-1,3-dien-1-yl]phosphane.
| Compound Name | [4-[(2E,4E)-5-[4-(4-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]hexa-2,4-dien-2-yl]cyclohexa-1,3-dien-1-yl]phosphane |
|---|---|
| PubChem CID | 144737043 |
| Molecular Formula | C25H31P |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | [4-[(2E,4E)-5-[4-(4-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]hexa-2,4-dien-2-yl]cyclohexa-1,3-dien-1-yl]phosphane |
| SMILES | CC1=CC=C(C2=CC=C(/C(C)=C/C=C(\C)C3=CC=C(P)CC3)CC2)CC1 |
| InChI | InChI=1S/C25H31P/c1-18-4-8-23(9-5-18)24-12-10-21(11-13-24)19(2)6-7-20(3)22-14-16-25(26)17-15-22/h4,6-8,10,12,14,16H,5,9,11,13,15,17,26H2,1-3H3/b19-6+,20-7+ |
| InChIKey | KPPDDZWWZXXDHO-UPICDLATSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|