C26H28F4 — CID 144809527
1-methyl-4-[3,3,4,4-tetrafluoro-5-[4-(4-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]hexa-1,5-dien-2-yl]cyclohexa-1,3-diene (PubChem CID 144809527) has the molecular formula C26H28F4 and a molecular weight of 416.50 g/mol. Its IUPAC name is 1-methyl-4-[3,3,4,4-tetrafluoro-5-[4-(4-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]hexa-1,5-dien-2-yl]cyclohexa-1,3-diene.
| Compound Name | 1-methyl-4-[3,3,4,4-tetrafluoro-5-[4-(4-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]hexa-1,5-dien-2-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144809527 |
| Molecular Formula | C26H28F4 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 1-methyl-4-[3,3,4,4-tetrafluoro-5-[4-(4-methylcyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]hexa-1,5-dien-2-yl]cyclohexa-1,3-diene |
| SMILES | C=C(C1=CC=C(C)CC1)C(F)(F)C(F)(F)C(=C)C1=CC=C(C2=CC=C(C)CC2)CC1 |
| InChI | InChI=1S/C26H28F4/c1-17-5-9-21(10-6-17)19(3)25(27,28)26(29,30)20(4)22-13-15-24(16-14-22)23-11-7-18(2)8-12-23/h5,7,9,11,13,15H,3-4,6,8,10,12,14,16H2,1-2H3 |
| InChIKey | GPZANNKXVQRTIO-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|