C11H17N3 — CID 145466964
(E)-N-(ethyldiazenyl)-1-(4-methylcyclohexa-1,3-dien-1-yl)ethanimine (PubChem CID 145466964) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is (E)-N-(ethyldiazenyl)-1-(4-methylcyclohexa-1,3-dien-1-yl)ethanimine.
| Compound Name | (E)-N-(ethyldiazenyl)-1-(4-methylcyclohexa-1,3-dien-1-yl)ethanimine |
|---|---|
| PubChem CID | 145466964 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | (E)-N-(ethyldiazenyl)-1-(4-methylcyclohexa-1,3-dien-1-yl)ethanimine |
| SMILES | CC/N=N/N=C(\C)C1=CC=C(C)CC1 |
| InChI | InChI=1S/C11H17N3/c1-4-12-14-13-10(3)11-7-5-9(2)6-8-11/h5,7H,4,6,8H2,1-3H3/b13-10+,14-12+ |
| InChIKey | GLRXLAGBICXNOX-ADWQEOMMSA-N |
| XLogP | 3.50 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|