C11H19N2O2+ — CID 163856263
methoxycarbamoyl-dimethyl-(4-methylcyclohexa-1,3-dien-1-yl)azanium (PubChem CID 163856263) has the molecular formula C11H19N2O2+ and a molecular weight of 211.28 g/mol. Its IUPAC name is methoxycarbamoyl-dimethyl-(4-methylcyclohexa-1,3-dien-1-yl)azanium.
| Compound Name | methoxycarbamoyl-dimethyl-(4-methylcyclohexa-1,3-dien-1-yl)azanium |
|---|---|
| PubChem CID | 163856263 |
| Molecular Formula | C11H19N2O2+ |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | methoxycarbamoyl-dimethyl-(4-methylcyclohexa-1,3-dien-1-yl)azanium |
| SMILES | CONC(=O)[N+](C)(C)C1=CC=C(C)CC1 |
| InChI | InChI=1S/C11H18N2O2/c1-9-5-7-10(8-6-9)13(2,3)11(14)12-15-4/h5,7H,6,8H2,1-4H3/p+1 |
| InChIKey | UYQXSXZQPXPZJB-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|