About 3-imino-4,6-dimethylidenecyclohexen-1-amine
3-imino-4,6-dimethylidenecyclohexen-1-amine (PubChem CID 102013794) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 3-imino-4,6-dimethylidenecyclohexen-1-amine.
Molecular Properties
| Compound Name | 3-imino-4,6-dimethylidenecyclohexen-1-amine |
| PubChem CID | 102013794 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 3-imino-4,6-dimethylidenecyclohexen-1-amine |
| SMILES | [H]/N=C1\C=C(N)C(=C)CC1=C |
| InChI | InChI=1S/C8H10N2/c1-5-3-6(2)8(10)4-7(5)9/h4,9H,1-3,10H2/b9-7+ |
| InChIKey | MVUBKBJEYLFRRO-VQHVLOKHSA-N |
| XLogP | 1.36 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-4,6-dimethylidenecyclohexen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-4,6-dimethylidenecyclohexen-1-amine?
The IUPAC name of 3-imino-4,6-dimethylidenecyclohexen-1-amine (CID 102013794) is 3-imino-4,6-dimethylidenecyclohexen-1-amine.
What is the SMILES notation for 3-imino-4,6-dimethylidenecyclohexen-1-amine?
The canonical SMILES for 3-imino-4,6-dimethylidenecyclohexen-1-amine is [H]/N=C1\C=C(N)C(=C)CC1=C.
What is the InChIKey of 3-imino-4,6-dimethylidenecyclohexen-1-amine?
The InChIKey is MVUBKBJEYLFRRO-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H10N2/c1-5-3-6(2)8(10)4-7(5)9/h4,9H,1-3,10H2/b9-7+.
What are the key properties of 3-imino-4,6-dimethylidenecyclohexen-1-amine?
3-imino-4,6-dimethylidenecyclohexen-1-amine has a molecular weight of 134.18 g/mol, XLogP of 1.36, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-4,6-dimethylidenecyclohexen-1-amine is sourced from PubChem (CID 102013794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).