C16H20N4O — CID 138503439
6-(4-aminophenyl)imino-4-butoxy-3-iminocyclohexa-1,4-dien-1-amine (PubChem CID 138503439) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 6-(4-aminophenyl)imino-4-butoxy-3-iminocyclohexa-1,4-dien-1-amine.
| Compound Name | 6-(4-aminophenyl)imino-4-butoxy-3-iminocyclohexa-1,4-dien-1-amine |
|---|---|
| PubChem CID | 138503439 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 6-(4-aminophenyl)imino-4-butoxy-3-iminocyclohexa-1,4-dien-1-amine |
| SMILES | [H]/N=C1\C=C(N)/C(=N/c2ccc(N)cc2)C=C1OCCCC |
| InChI | InChI=1S/C16H20N4O/c1-2-3-8-21-16-10-15(13(18)9-14(16)19)20-12-6-4-11(17)5-7-12/h4-7,9-10,19H,2-3,8,17-18H2,1H3/b19-14+,20-15+ |
| InChIKey | FNGRSRMRPNHWTI-PXXPDPNMSA-N |
| XLogP | 2.92 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|