C17H22N4O2 — CID 123568757
2-[3-(4-aminophenyl)imino-4-[ethyl(methyl)amino]-6-iminocyclohexa-1,4-dien-1-yl]oxyethanol (PubChem CID 123568757) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-[3-(4-aminophenyl)imino-4-[ethyl(methyl)amino]-6-iminocyclohexa-1,4-dien-1-yl]oxyethanol.
| Compound Name | 2-[3-(4-aminophenyl)imino-4-[ethyl(methyl)amino]-6-iminocyclohexa-1,4-dien-1-yl]oxyethanol |
|---|---|
| PubChem CID | 123568757 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-[3-(4-aminophenyl)imino-4-[ethyl(methyl)amino]-6-iminocyclohexa-1,4-dien-1-yl]oxyethanol |
| SMILES | [H]/N=C1\C=C(N(C)CC)/C(=N/c2ccc(N)cc2)C=C1OCCO |
| InChI | InChI=1S/C17H22N4O2/c1-3-21(2)16-10-14(19)17(23-9-8-22)11-15(16)20-13-6-4-12(18)5-7-13/h4-7,10-11,19,22H,3,8-9,18H2,1-2H3/b19-14+,20-15+ |
| InChIKey | ZAFCHRBOFYQILA-PXXPDPNMSA-N |
| XLogP | 2.10 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|