C13H20N2OS2 — CID 122370634
2-(4-aminophenoxy)ethyl N,N-diethylcarbamodithioate (PubChem CID 122370634) has the molecular formula C13H20N2OS2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-(4-aminophenoxy)ethyl N,N-diethylcarbamodithioate.
| Compound Name | 2-(4-aminophenoxy)ethyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 122370634 |
| Molecular Formula | C13H20N2OS2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(4-aminophenoxy)ethyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCCOc1ccc(N)cc1 |
| InChI | InChI=1S/C13H20N2OS2/c1-3-15(4-2)13(17)18-10-9-16-12-7-5-11(14)6-8-12/h5-8H,3-4,9-10,14H2,1-2H3 |
| InChIKey | LSUNBKNQNDKCNV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|