C13H25NO2S2 — CID 118000269
2-(diethylcarbamothioylsulfanyl)ethyl 2,2-dimethylbutanoate (PubChem CID 118000269) has the molecular formula C13H25NO2S2 and a molecular weight of 291.48 g/mol. Its IUPAC name is 2-(diethylcarbamothioylsulfanyl)ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(diethylcarbamothioylsulfanyl)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118000269 |
| Molecular Formula | C13H25NO2S2 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-(diethylcarbamothioylsulfanyl)ethyl 2,2-dimethylbutanoate |
| SMILES | CCN(CC)C(=S)SCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C13H25NO2S2/c1-6-13(4,5)11(15)16-9-10-18-12(17)14(7-2)8-3/h6-10H2,1-5H3 |
| InChIKey | OVUYFGNDCSJGGN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|