C8H9NO2S — CID 101233754
6-imino-3,4-dimethoxycyclohexa-2,4-diene-1-thione (PubChem CID 101233754) has the molecular formula C8H9NO2S and a molecular weight of 183.23 g/mol. Its IUPAC name is 6-imino-3,4-dimethoxycyclohexa-2,4-diene-1-thione.
| Compound Name | 6-imino-3,4-dimethoxycyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 101233754 |
| Molecular Formula | C8H9NO2S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.04 |
| IUPAC Name | 6-imino-3,4-dimethoxycyclohexa-2,4-diene-1-thione |
| SMILES | [H]/N=C1\C=C(OC)C(OC)=CC1=S |
| InChI | InChI=1S/C8H9NO2S/c1-10-6-3-5(9)8(12)4-7(6)11-2/h3-4,9H,1-2H3/b9-5+ |
| InChIKey | ZXLUCNMDDGWKEE-WEVVVXLNSA-N |
| XLogP | 1.45 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|