C11H21N3 — CID 143629749
4,5-dimethylcyclohexa-3,5-diene-1,2-diimine;ethane;methanamine (PubChem CID 143629749) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 4,5-dimethylcyclohexa-3,5-diene-1,2-diimine;ethane;methanamine.
| Compound Name | 4,5-dimethylcyclohexa-3,5-diene-1,2-diimine;ethane;methanamine |
|---|---|
| PubChem CID | 143629749 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 4,5-dimethylcyclohexa-3,5-diene-1,2-diimine;ethane;methanamine |
| SMILES | CC.CN.[H]/N=C1\C=C(C)C(C)=C\C1=N/[H] |
| InChI | InChI=1S/C8H10N2.C2H6.CH5N/c1-5-3-7(9)8(10)4-6(5)2;2*1-2/h3-4,9-10H,1-2H3;1-2H3;2H2,1H3/b9-7+,10-8+;; |
| InChIKey | GEFIYVLRZSLWOK-QZKABRJGSA-N |
| XLogP | 2.53 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|