C7H8N2O — CID 145492707
(3,4-diiminocyclohexa-1,5-dien-1-yl)methanol (PubChem CID 145492707) has the molecular formula C7H8N2O and a molecular weight of 136.15 g/mol. Its IUPAC name is (3,4-diiminocyclohexa-1,5-dien-1-yl)methanol.
| Compound Name | (3,4-diiminocyclohexa-1,5-dien-1-yl)methanol |
|---|---|
| PubChem CID | 145492707 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | (3,4-diiminocyclohexa-1,5-dien-1-yl)methanol |
| SMILES | [H]/N=C1\C=CC(CO)=C\C1=N/[H] |
| InChI | InChI=1S/C7H8N2O/c8-6-2-1-5(4-10)3-7(6)9/h1-3,8-10H,4H2/b8-6+,9-7+ |
| InChIKey | MPRCXRFPVULFNQ-CDJQDVQCSA-N |
| XLogP | 0.51 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|