C16H18N2 — CID 123487692
2-ethyl-4-[(4-imino-3-methylidenecyclohexa-1,5-dien-1-yl)methyl]aniline (PubChem CID 123487692) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-ethyl-4-[(4-imino-3-methylidenecyclohexa-1,5-dien-1-yl)methyl]aniline.
| Compound Name | 2-ethyl-4-[(4-imino-3-methylidenecyclohexa-1,5-dien-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 123487692 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-ethyl-4-[(4-imino-3-methylidenecyclohexa-1,5-dien-1-yl)methyl]aniline |
| SMILES | [H]/N=C1\C=CC(Cc2ccc(N)c(CC)c2)=CC1=C |
| InChI | InChI=1S/C16H18N2/c1-3-14-10-13(5-7-16(14)18)9-12-4-6-15(17)11(2)8-12/h4-8,10,17H,2-3,9,18H2,1H3/b17-15+ |
| InChIKey | FXRBCMNICCIINH-BMRADRMJSA-N |
| XLogP | 3.45 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|