C25H30N2O — CID 59364765
4-[1-[4-[(4-amino-3-ethylphenyl)methyl]-2-ethylanilino]ethyl]phenol (PubChem CID 59364765) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is 4-[1-[4-[(4-amino-3-ethylphenyl)methyl]-2-ethylanilino]ethyl]phenol.
| Compound Name | 4-[1-[4-[(4-amino-3-ethylphenyl)methyl]-2-ethylanilino]ethyl]phenol |
|---|---|
| PubChem CID | 59364765 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 4-[1-[4-[(4-amino-3-ethylphenyl)methyl]-2-ethylanilino]ethyl]phenol |
| SMILES | CCc1cc(Cc2ccc(NC(C)c3ccc(O)cc3)c(CC)c2)ccc1N |
| InChI | InChI=1S/C25H30N2O/c1-4-20-15-18(6-12-24(20)26)14-19-7-13-25(21(5-2)16-19)27-17(3)22-8-10-23(28)11-9-22/h6-13,15-17,27-28H,4-5,14,26H2,1-3H3 |
| InChIKey | JXPISEHOPVUDHP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|