C27H34N2O — CID 59364811
4-[1-[4-[(4-amino-3-ethylphenyl)methyl]-2-ethylanilino]butyl]phenol (PubChem CID 59364811) has the molecular formula C27H34N2O and a molecular weight of 402.58 g/mol. Its IUPAC name is 4-[1-[4-[(4-amino-3-ethylphenyl)methyl]-2-ethylanilino]butyl]phenol.
| Compound Name | 4-[1-[4-[(4-amino-3-ethylphenyl)methyl]-2-ethylanilino]butyl]phenol |
|---|---|
| PubChem CID | 59364811 |
| Molecular Formula | C27H34N2O |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 4-[1-[4-[(4-amino-3-ethylphenyl)methyl]-2-ethylanilino]butyl]phenol |
| SMILES | CCCC(Nc1ccc(Cc2ccc(N)c(CC)c2)cc1CC)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H34N2O/c1-4-7-26(23-10-12-24(30)13-11-23)29-27-15-9-20(18-22(27)6-3)16-19-8-14-25(28)21(5-2)17-19/h8-15,17-18,26,29-30H,4-7,16,28H2,1-3H3 |
| InChIKey | GJQWOLHQJYWFFQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|