C30H40N2O — CID 59364779
4-[1-[4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylanilino]propyl]phenol (PubChem CID 59364779) has the molecular formula C30H40N2O and a molecular weight of 444.66 g/mol. Its IUPAC name is 4-[1-[4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylanilino]propyl]phenol.
| Compound Name | 4-[1-[4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylanilino]propyl]phenol |
|---|---|
| PubChem CID | 59364779 |
| Molecular Formula | C30H40N2O |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 4-[1-[4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylanilino]propyl]phenol |
| SMILES | CCc1cc(Cc2cc(CC)c(NC(CC)c3ccc(O)cc3)c(CC)c2)cc(CC)c1N |
| InChI | InChI=1S/C30H40N2O/c1-6-22-16-20(17-23(7-2)29(22)31)15-21-18-24(8-3)30(25(9-4)19-21)32-28(10-5)26-11-13-27(33)14-12-26/h11-14,16-19,28,32-33H,6-10,15,31H2,1-5H3 |
| InChIKey | KLTMXSYRLJOCKP-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|