About 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline
4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline (PubChem CID 159562254) has the molecular formula C33H44N4
and a molecular weight of 496.74 g/mol. Its IUPAC name is 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline.
Molecular Properties
| Compound Name | 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline |
| PubChem CID | 159562254 |
| Molecular Formula | C33H44N4 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline |
| SMILES | CCc1cc(Cc2cc(CC)c(N)c(CC)c2)cc(CC)c1N.Nc1ccccc1.Nc1ccccc1 |
| InChI | InChI=1S/C21H30N2.2C6H7N/c1-5-16-10-14(11-17(6-2)20(16)22)9-15-12-18(7-3)21(23)19(8-4)13-15;2*7-6-4-2-1-3-5-6/h10-13H,5-9,22-23H2,1-4H3;2*1-5H,7H2 |
| InChIKey | MGTQKSSVDGFYJI-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline?
The IUPAC name of 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline (CID 159562254) is 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline.
What is the SMILES notation for 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline?
The canonical SMILES for 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline is CCc1cc(Cc2cc(CC)c(N)c(CC)c2)cc(CC)c1N.Nc1ccccc1.Nc1ccccc1.
What is the InChIKey of 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline?
The InChIKey is MGTQKSSVDGFYJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N2.2C6H7N/c1-5-16-10-14(11-17(6-2)20(16)22)9-15-12-18(7-3)21(23)19(8-4)13-15;2*7-6-4-2-1-3-5-6/h10-13H,5-9,22-23H2,1-4H3;2*1-5H,7H2.
What are the key properties of 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline?
4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline has a molecular weight of 496.74 g/mol, XLogP of 7.23, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline is sourced from PubChem (CID 159562254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).