C33H44N4 — CID 159562254
4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline (PubChem CID 159562254) has the molecular formula C33H44N4 and a molecular weight of 496.74 g/mol. Its IUPAC name is 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline.
| Compound Name | 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline |
|---|---|
| PubChem CID | 159562254 |
| Molecular Formula | C33H44N4 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline;aniline |
| SMILES | CCc1cc(Cc2cc(CC)c(N)c(CC)c2)cc(CC)c1N.Nc1ccccc1.Nc1ccccc1 |
| InChI | InChI=1S/C21H30N2.2C6H7N/c1-5-16-10-14(11-17(6-2)20(16)22)9-15-12-18(7-3)21(23)19(8-4)13-15;2*7-6-4-2-1-3-5-6/h10-13H,5-9,22-23H2,1-4H3;2*1-5H,7H2 |
| InChIKey | MGTQKSSVDGFYJI-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|