C12H19N3O2 — CID 83110517
2-[1-(4-hydroxyphenyl)propylamino]ethylurea (PubChem CID 83110517) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-[1-(4-hydroxyphenyl)propylamino]ethylurea.
| Compound Name | 2-[1-(4-hydroxyphenyl)propylamino]ethylurea |
|---|---|
| PubChem CID | 83110517 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-[1-(4-hydroxyphenyl)propylamino]ethylurea |
| SMILES | CCC(NCCNC(N)=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H19N3O2/c1-2-11(14-7-8-15-12(13)17)9-3-5-10(16)6-4-9/h3-6,11,14,16H,2,7-8H2,1H3,(H3,13,15,17) |
| InChIKey | KCJIYTPMPWDLCF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|