C13H21NO3 — CID 54921747
4-[1-(2,2-dimethoxyethylamino)propyl]phenol (PubChem CID 54921747) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 4-[1-(2,2-dimethoxyethylamino)propyl]phenol.
| Compound Name | 4-[1-(2,2-dimethoxyethylamino)propyl]phenol |
|---|---|
| PubChem CID | 54921747 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 4-[1-(2,2-dimethoxyethylamino)propyl]phenol |
| SMILES | CCC(NCC(OC)OC)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H21NO3/c1-4-12(14-9-13(16-2)17-3)10-5-7-11(15)8-6-10/h5-8,12-15H,4,9H2,1-3H3 |
| InChIKey | RRJPKZIBOMKTRO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|