C24H26N2O — CID 135997102
4-[[4-[(4-amino-3-ethylphenyl)methyl]-2-ethylphenyl]iminomethyl]phenol (PubChem CID 135997102) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-[[4-[(4-amino-3-ethylphenyl)methyl]-2-ethylphenyl]iminomethyl]phenol.
| Compound Name | 4-[[4-[(4-amino-3-ethylphenyl)methyl]-2-ethylphenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135997102 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 4-[[4-[(4-amino-3-ethylphenyl)methyl]-2-ethylphenyl]iminomethyl]phenol |
| SMILES | CCc1cc(Cc2ccc(/N=C/c3ccc(O)cc3)c(CC)c2)ccc1N |
| InChI | InChI=1S/C24H26N2O/c1-3-20-14-18(7-11-23(20)25)13-19-8-12-24(21(4-2)15-19)26-16-17-5-9-22(27)10-6-17/h5-12,14-16,27H,3-4,13,25H2,1-2H3/b26-16+ |
| InChIKey | JWVMEVUGUYKHOT-WGOQTCKBSA-N |
| XLogP | 5.44 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|