C9H11NO — CID 123288429
[(1E,4Z,6Z)-8-iminocycloocta-1,4,6-trien-1-yl]methanol (PubChem CID 123288429) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is [(1E,4Z,6Z)-8-iminocycloocta-1,4,6-trien-1-yl]methanol.
| Compound Name | [(1E,4Z,6Z)-8-iminocycloocta-1,4,6-trien-1-yl]methanol |
|---|---|
| PubChem CID | 123288429 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | [(1E,4Z,6Z)-8-iminocycloocta-1,4,6-trien-1-yl]methanol |
| SMILES | [H]/N=C1\C=C/C=C\C/C=C\1CO |
| InChI | InChI=1S/C9H11NO/c10-9-6-4-2-1-3-5-8(9)7-11/h1-2,4-6,10-11H,3,7H2/b2-1-,6-4-,8-5-,10-9+ |
| InChIKey | PBLWXRLCJNOIDZ-PWINEWMFSA-N |
| XLogP | 1.44 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|