C6H5NO2S — CID 141423215
6-sulfonylcyclohexa-2,4-dien-1-imine (PubChem CID 141423215) has the molecular formula C6H5NO2S and a molecular weight of 155.18 g/mol. Its IUPAC name is 6-sulfonylcyclohexa-2,4-dien-1-imine.
| Compound Name | 6-sulfonylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 141423215 |
| Molecular Formula | C6H5NO2S |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.00 |
| IUPAC Name | 6-sulfonylcyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=CC1=S(=O)=O |
| InChI | InChI=1S/C6H5NO2S/c7-5-3-1-2-4-6(5)10(8)9/h1-4,7H/b7-5+ |
| InChIKey | QGOYNAMDHRKBLE-FNORWQNLSA-N |
| XLogP | 0.18 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|