C10H16N2S — CID 143288825
2-N-methylsulfanylcyclohexa-3,5-diene-1,2-diimine;propane (PubChem CID 143288825) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 2-N-methylsulfanylcyclohexa-3,5-diene-1,2-diimine;propane.
| Compound Name | 2-N-methylsulfanylcyclohexa-3,5-diene-1,2-diimine;propane |
|---|---|
| PubChem CID | 143288825 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-N-methylsulfanylcyclohexa-3,5-diene-1,2-diimine;propane |
| SMILES | CCC.[H]/N=C1\C=CC=C\C1=N\SC |
| InChI | InChI=1S/C7H8N2S.C3H8/c1-10-9-7-5-3-2-4-6(7)8;1-3-2/h2-5,8H,1H3;3H2,1-2H3/b8-6+,9-7-; |
| InChIKey | OGQFZOLZWDEWEG-ULCBHPGJSA-N |
| XLogP | 3.27 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|