C24H39N3 — CID 144748432
3,5-bis(2-methylbutan-2-yl)aniline;cyclohexa-3,5-diene-1,2-diimine;ethane (PubChem CID 144748432) has the molecular formula C24H39N3 and a molecular weight of 369.60 g/mol. Its IUPAC name is 3,5-bis(2-methylbutan-2-yl)aniline;cyclohexa-3,5-diene-1,2-diimine;ethane.
| Compound Name | 3,5-bis(2-methylbutan-2-yl)aniline;cyclohexa-3,5-diene-1,2-diimine;ethane |
|---|---|
| PubChem CID | 144748432 |
| Molecular Formula | C24H39N3 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 369.31 |
| IUPAC Name | 3,5-bis(2-methylbutan-2-yl)aniline;cyclohexa-3,5-diene-1,2-diimine;ethane |
| SMILES | CC.CCC(C)(C)c1cc(N)cc(C(C)(C)CC)c1.[H]/N=C1\C=CC=C\C1=N/[H] |
| InChI | InChI=1S/C16H27N.C6H6N2.C2H6/c1-7-15(3,4)12-9-13(11-14(17)10-12)16(5,6)8-2;7-5-3-1-2-4-6(5)8;1-2/h9-11H,7-8,17H2,1-6H3;1-4,7-8H;1-2H3/b;7-5+,8-6+; |
| InChIKey | RVYQFJNUUYEEDS-UJPCKICKSA-N |
| XLogP | 6.82 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|