C42H70P2 — CID 15666236
[2,4,6-tris(2-methylbutan-2-yl)phenyl]-[2,4,6-tris(2-methylbutan-2-yl)phenyl]phosphanylidenephosphane (PubChem CID 15666236) has the molecular formula C42H70P2 and a molecular weight of 636.97 g/mol. Its IUPAC name is [2,4,6-tris(2-methylbutan-2-yl)phenyl]-[2,4,6-tris(2-methylbutan-2-yl)phenyl]phosphanylidenephosphane.
| Compound Name | [2,4,6-tris(2-methylbutan-2-yl)phenyl]-[2,4,6-tris(2-methylbutan-2-yl)phenyl]phosphanylidenephosphane |
|---|---|
| PubChem CID | 15666236 |
| Molecular Formula | C42H70P2 |
| Molecular Weight | 636.97 g/mol |
| Exact Mass | 636.50 |
| IUPAC Name | [2,4,6-tris(2-methylbutan-2-yl)phenyl]-[2,4,6-tris(2-methylbutan-2-yl)phenyl]phosphanylidenephosphane |
| SMILES | CCC(C)(C)c1cc(C(C)(C)CC)c(/P=P/c2c(C(C)(C)CC)cc(C(C)(C)CC)cc2C(C)(C)CC)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C42H70P2/c1-19-37(7,8)29-25-31(39(11,12)21-3)35(32(26-29)40(13,14)22-4)43-44-36-33(41(15,16)23-5)27-30(38(9,10)20-2)28-34(36)42(17,18)24-6/h25-28H,19-24H2,1-18H3 |
| InChIKey | GKRFPNUAFHDUBJ-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.97 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|