C16H25O2S- — CID 174420487
2,4-bis(2-methylbutan-2-yl)benzenesulfinate (PubChem CID 174420487) has the molecular formula C16H25O2S- and a molecular weight of 281.44 g/mol. Its IUPAC name is 2,4-bis(2-methylbutan-2-yl)benzenesulfinate.
| Compound Name | 2,4-bis(2-methylbutan-2-yl)benzenesulfinate |
|---|---|
| PubChem CID | 174420487 |
| Molecular Formula | C16H25O2S- |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2,4-bis(2-methylbutan-2-yl)benzenesulfinate |
| SMILES | CCC(C)(C)c1ccc(S(=O)[O-])c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C16H26O2S/c1-7-15(3,4)12-9-10-14(19(17)18)13(11-12)16(5,6)8-2/h9-11H,7-8H2,1-6H3,(H,17,18)/p-1 |
| InChIKey | ALYMMUIORBCFCN-UHFFFAOYSA-M |
| XLogP | 4.30 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|