C13H17N3 — CID 143547651
cyclohexa-3,5-diene-1,2-diimine;(1E,3Z,5Z)-hepta-1,3,5-trien-1-amine (PubChem CID 143547651) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is cyclohexa-3,5-diene-1,2-diimine;(1E,3Z,5Z)-hepta-1,3,5-trien-1-amine.
| Compound Name | cyclohexa-3,5-diene-1,2-diimine;(1E,3Z,5Z)-hepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 143547651 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | cyclohexa-3,5-diene-1,2-diimine;(1E,3Z,5Z)-hepta-1,3,5-trien-1-amine |
| SMILES | C/C=C\C=C/C=C/N.[H]/N=C1\C=CC=C\C1=N/[H] |
| InChI | InChI=1S/C7H11N.C6H6N2/c1-2-3-4-5-6-7-8;7-5-3-1-2-4-6(5)8/h2-7H,8H2,1H3;1-4,7-8H/b3-2-,5-4-,7-6+;7-5+,8-6+ |
| InChIKey | YNZXHSVWIBZQHL-YTYVHJDSSA-N |
| XLogP | 2.74 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|