C12H19IN2O2 — CID 138398554
(Z)-(6-iminocyclohexa-2,4-dien-1-ylidene)-[2-(trimethylazaniumyl)ethoxy]methanolate;hydroiodide (PubChem CID 138398554) has the molecular formula C12H19IN2O2 and a molecular weight of 350.20 g/mol. Its IUPAC name is (Z)-(6-iminocyclohexa-2,4-dien-1-ylidene)-[2-(trimethylazaniumyl)ethoxy]methanolate;hydroiodide.
| Compound Name | (Z)-(6-iminocyclohexa-2,4-dien-1-ylidene)-[2-(trimethylazaniumyl)ethoxy]methanolate;hydroiodide |
|---|---|
| PubChem CID | 138398554 |
| Molecular Formula | C12H19IN2O2 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (Z)-(6-iminocyclohexa-2,4-dien-1-ylidene)-[2-(trimethylazaniumyl)ethoxy]methanolate;hydroiodide |
| SMILES | I.[H]/N=C1\C=CC=C\C1=C(/[O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C12H18N2O2.HI/c1-14(2,3)8-9-16-12(15)10-6-4-5-7-11(10)13;/h4-7H,8-9H2,1-3H3,(H-,13,15);1H |
| InChIKey | SAVBGUYMLYHAAR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|