C28H44N2O2+2 — CID 102058066
trimethyl-[2-[4-[(Z)-4-[4-[2-(trimethylazaniumyl)ethoxy]phenyl]hex-3-en-3-yl]phenoxy]ethyl]azanium (PubChem CID 102058066) has the molecular formula C28H44N2O2+2 and a molecular weight of 440.67 g/mol. Its IUPAC name is trimethyl-[2-[4-[(Z)-4-[4-[2-(trimethylazaniumyl)ethoxy]phenyl]hex-3-en-3-yl]phenoxy]ethyl]azanium.
| Compound Name | trimethyl-[2-[4-[(Z)-4-[4-[2-(trimethylazaniumyl)ethoxy]phenyl]hex-3-en-3-yl]phenoxy]ethyl]azanium |
|---|---|
| PubChem CID | 102058066 |
| Molecular Formula | C28H44N2O2+2 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.34 |
| IUPAC Name | trimethyl-[2-[4-[(Z)-4-[4-[2-(trimethylazaniumyl)ethoxy]phenyl]hex-3-en-3-yl]phenoxy]ethyl]azanium |
| SMILES | CC/C(=C(\CC)c1ccc(OCC[N+](C)(C)C)cc1)c1ccc(OCC[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C28H44N2O2/c1-9-27(23-11-15-25(16-12-23)31-21-19-29(3,4)5)28(10-2)24-13-17-26(18-14-24)32-22-20-30(6,7)8/h11-18H,9-10,19-22H2,1-8H3/q+2/b28-27- |
| InChIKey | JQEUPBPDCUVEHA-DQSJHHFOSA-N |
| XLogP | 5.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|