C44H54NaO6P — CID 158307439
sodium bis[4-[4-(4-butoxyphenyl)hex-3-en-3-yl]phenyl] phosphate (PubChem CID 158307439) has the molecular formula C44H54NaO6P and a molecular weight of 732.87 g/mol. Its IUPAC name is sodium bis[4-[4-(4-butoxyphenyl)hex-3-en-3-yl]phenyl] phosphate.
| Compound Name | sodium bis[4-[4-(4-butoxyphenyl)hex-3-en-3-yl]phenyl] phosphate |
|---|---|
| PubChem CID | 158307439 |
| Molecular Formula | C44H54NaO6P |
| Molecular Weight | 732.87 g/mol |
| Exact Mass | 732.36 |
| IUPAC Name | sodium bis[4-[4-(4-butoxyphenyl)hex-3-en-3-yl]phenyl] phosphate |
| SMILES | CCCCOc1ccc(C(CC)=C(CC)c2ccc(OP(=O)([O-])Oc3ccc(C(CC)=C(CC)c4ccc(OCCCC)cc4)cc3)cc2)cc1.[Na+] |
| InChI | InChI=1S/C44H55O6P.Na/c1-7-13-31-47-37-23-15-33(16-24-37)41(9-3)43(11-5)35-19-27-39(28-20-35)49-51(45,46)50-40-29-21-36(22-30-40)44(12-6)42(10-4)34-17-25-38(26-18-34)48-32-14-8-2;/h15-30H,7-14,31-32H2,1-6H3,(H,45,46);/q;+1/p-1 |
| InChIKey | GNGHLFDGUUIRGA-UHFFFAOYSA-M |
| XLogP | 9.44 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.87 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|