C25H26NaO5P — CID 23702042
sodium [4-[(E)-4-(4-methoxyphenyl)hex-3-en-3-yl]phenyl] phenyl phosphate (PubChem CID 23702042) has the molecular formula C25H26NaO5P and a molecular weight of 460.44 g/mol. Its IUPAC name is sodium [4-[(E)-4-(4-methoxyphenyl)hex-3-en-3-yl]phenyl] phenyl phosphate.
| Compound Name | sodium [4-[(E)-4-(4-methoxyphenyl)hex-3-en-3-yl]phenyl] phenyl phosphate |
|---|---|
| PubChem CID | 23702042 |
| Molecular Formula | C25H26NaO5P |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | sodium [4-[(E)-4-(4-methoxyphenyl)hex-3-en-3-yl]phenyl] phenyl phosphate |
| SMILES | CC/C(=C(/CC)c1ccc(OP(=O)([O-])Oc2ccccc2)cc1)c1ccc(OC)cc1.[Na+] |
| InChI | InChI=1S/C25H27O5P.Na/c1-4-24(19-11-15-21(28-3)16-12-19)25(5-2)20-13-17-23(18-14-20)30-31(26,27)29-22-9-7-6-8-10-22;/h6-18H,4-5H2,1-3H3,(H,26,27);/q;+1/p-1/b25-24+; |
| InChIKey | OJKKEDRTNABWLP-QREUMGABSA-M |
| XLogP | 3.36 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|