C18H20Na2O8P2 — CID 3034879
disodium;[4-[(Z)-4-[4-[hydroxy(oxido)phosphoryl]oxyphenyl]hex-3-en-3-yl]phenyl] hydrogen phosphate (PubChem CID 3034879) has the molecular formula C18H20Na2O8P2 and a molecular weight of 472.28 g/mol. Its IUPAC name is disodium;[4-[(Z)-4-[4-[hydroxy(oxido)phosphoryl]oxyphenyl]hex-3-en-3-yl]phenyl] hydrogen phosphate.
| Compound Name | disodium;[4-[(Z)-4-[4-[hydroxy(oxido)phosphoryl]oxyphenyl]hex-3-en-3-yl]phenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 3034879 |
| Molecular Formula | C18H20Na2O8P2 |
| Molecular Weight | 472.28 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | disodium;[4-[(Z)-4-[4-[hydroxy(oxido)phosphoryl]oxyphenyl]hex-3-en-3-yl]phenyl] hydrogen phosphate |
| SMILES | CC/C(=C(\CC)c1ccc(OP(=O)([O-])O)cc1)c1ccc(OP(=O)([O-])O)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C18H22O8P2.2Na/c1-3-17(13-5-9-15(10-6-13)25-27(19,20)21)18(4-2)14-7-11-16(12-8-14)26-28(22,23)24;;/h5-12H,3-4H2,1-2H3,(H2,19,20,21)(H2,22,23,24);;/q;2*+1/p-2/b18-17-;; |
| InChIKey | OPZDSBAHQHNXRQ-NSGFTINJSA-L |
| XLogP | -2.90 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.28 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|