C58H92N4O4+4 — CID 44611206
triethyl-[2-[4-[1,2,2-tris[4-[2-(triethylazaniumyl)ethoxy]phenyl]ethenyl]phenoxy]ethyl]azanium (PubChem CID 44611206) has the molecular formula C58H92N4O4+4 and a molecular weight of 909.40 g/mol. Its IUPAC name is triethyl-[2-[4-[1,2,2-tris[4-[2-(triethylazaniumyl)ethoxy]phenyl]ethenyl]phenoxy]ethyl]azanium.
| Compound Name | triethyl-[2-[4-[1,2,2-tris[4-[2-(triethylazaniumyl)ethoxy]phenyl]ethenyl]phenoxy]ethyl]azanium |
|---|---|
| PubChem CID | 44611206 |
| Molecular Formula | C58H92N4O4+4 |
| Molecular Weight | 909.40 g/mol |
| Exact Mass | 908.71 |
| IUPAC Name | triethyl-[2-[4-[1,2,2-tris[4-[2-(triethylazaniumyl)ethoxy]phenyl]ethenyl]phenoxy]ethyl]azanium |
| SMILES | CC[N+](CC)(CC)CCOc1ccc(C(=C(c2ccc(OCC[N+](CC)(CC)CC)cc2)c2ccc(OCC[N+](CC)(CC)CC)cc2)c2ccc(OCC[N+](CC)(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C58H92N4O4/c1-13-59(14-2,15-3)41-45-63-53-33-25-49(26-34-53)57(50-27-35-54(36-28-50)64-46-42-60(16-4,17-5)18-6)58(51-29-37-55(38-30-51)65-47-43-61(19-7,20-8)21-9)52-31-39-56(40-32-52)66-48-44-62(22-10,23-11)24-12/h25-40H,13-24,41-48H2,1-12H3/q+4 |
| InChIKey | BJTXLSWOOXDZBQ-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.40 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|