C32H50N2O2+2 — CID 24833143
2-[4-[(2E,4E)-4-[4-[2-[diethyl(methyl)azaniumyl]ethoxy]phenyl]hexa-2,4-dien-3-yl]phenoxy]ethyl-diethyl-methylazanium (PubChem CID 24833143) has the molecular formula C32H50N2O2+2 and a molecular weight of 494.76 g/mol. Its IUPAC name is 2-[4-[(2E,4E)-4-[4-[2-[diethyl(methyl)azaniumyl]ethoxy]phenyl]hexa-2,4-dien-3-yl]phenoxy]ethyl-diethyl-methylazanium.
| Compound Name | 2-[4-[(2E,4E)-4-[4-[2-[diethyl(methyl)azaniumyl]ethoxy]phenyl]hexa-2,4-dien-3-yl]phenoxy]ethyl-diethyl-methylazanium |
|---|---|
| PubChem CID | 24833143 |
| Molecular Formula | C32H50N2O2+2 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.39 |
| IUPAC Name | 2-[4-[(2E,4E)-4-[4-[2-[diethyl(methyl)azaniumyl]ethoxy]phenyl]hexa-2,4-dien-3-yl]phenoxy]ethyl-diethyl-methylazanium |
| SMILES | C/C=C(C(=C/C)/c1ccc(OCC[N+](C)(CC)CC)cc1)\c1ccc(OCC[N+](C)(CC)CC)cc1 |
| InChI | InChI=1S/C32H50N2O2/c1-9-31(27-15-19-29(20-16-27)35-25-23-33(7,11-3)12-4)32(10-2)28-17-21-30(22-18-28)36-26-24-34(8,13-5)14-6/h9-10,15-22H,11-14,23-26H2,1-8H3/q+2/b31-9+,32-10+ |
| InChIKey | AHWIIVWIIUMKLR-BQVZVJNFSA-N |
| XLogP | 6.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|