C34H50Br2N2O4 — CID 6446437
4-ethyl-4-[2-[4-[(2E,4E)-4-[4-[2-(4-ethylmorpholin-4-ium-4-yl)ethoxy]phenyl]hexa-2,4-dien-3-yl]phenoxy]ethyl]morpholin-4-ium dibromide (PubChem CID 6446437) has the molecular formula C34H50Br2N2O4 and a molecular weight of 710.59 g/mol. Its IUPAC name is 4-ethyl-4-[2-[4-[(2E,4E)-4-[4-[2-(4-ethylmorpholin-4-ium-4-yl)ethoxy]phenyl]hexa-2,4-dien-3-yl]phenoxy]ethyl]morpholin-4-ium dibromide.
| Compound Name | 4-ethyl-4-[2-[4-[(2E,4E)-4-[4-[2-(4-ethylmorpholin-4-ium-4-yl)ethoxy]phenyl]hexa-2,4-dien-3-yl]phenoxy]ethyl]morpholin-4-ium dibromide |
|---|---|
| PubChem CID | 6446437 |
| Molecular Formula | C34H50Br2N2O4 |
| Molecular Weight | 710.59 g/mol |
| Exact Mass | 708.21 |
| IUPAC Name | 4-ethyl-4-[2-[4-[(2E,4E)-4-[4-[2-(4-ethylmorpholin-4-ium-4-yl)ethoxy]phenyl]hexa-2,4-dien-3-yl]phenoxy]ethyl]morpholin-4-ium dibromide |
| SMILES | C/C=C(C(=C/C)/c1ccc(OCC[N+]2(CC)CCOCC2)cc1)\c1ccc(OCC[N+]2(CC)CCOCC2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C34H50N2O4.2BrH/c1-5-33(29-9-13-31(14-10-29)39-27-21-35(7-3)17-23-37-24-18-35)34(6-2)30-11-15-32(16-12-30)40-28-22-36(8-4)19-25-38-26-20-36;;/h5-6,9-16H,7-8,17-28H2,1-4H3;2*1H/q+2;;/p-2/b33-5+,34-6+;; |
| InChIKey | BVMMLCJALIRWFW-WLLMQTFBSA-L |
| XLogP | -0.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.59 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|