C18H25NO2 — CID 138514968
4-[(3E)-4-(4-butoxyphenyl)buta-1,3-dien-2-yl]morpholine (PubChem CID 138514968) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 4-[(3E)-4-(4-butoxyphenyl)buta-1,3-dien-2-yl]morpholine.
| Compound Name | 4-[(3E)-4-(4-butoxyphenyl)buta-1,3-dien-2-yl]morpholine |
|---|---|
| PubChem CID | 138514968 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 4-[(3E)-4-(4-butoxyphenyl)buta-1,3-dien-2-yl]morpholine |
| SMILES | C=C(/C=C/c1ccc(OCCCC)cc1)N1CCOCC1 |
| InChI | InChI=1S/C18H25NO2/c1-3-4-13-21-18-9-7-17(8-10-18)6-5-16(2)19-11-14-20-15-12-19/h5-10H,2-4,11-15H2,1H3/b6-5+ |
| InChIKey | WCNMMNUPXWNSPP-AATRIKPKSA-N |
| XLogP | 3.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|