C50H58O4 — CID 102046823
1,4-bis[2,2-bis(4-butoxyphenyl)ethenyl]benzene (PubChem CID 102046823) has the molecular formula C50H58O4 and a molecular weight of 723.01 g/mol. Its IUPAC name is 1,4-bis[2,2-bis(4-butoxyphenyl)ethenyl]benzene.
| Compound Name | 1,4-bis[2,2-bis(4-butoxyphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 102046823 |
| Molecular Formula | C50H58O4 |
| Molecular Weight | 723.01 g/mol |
| Exact Mass | 722.43 |
| IUPAC Name | 1,4-bis[2,2-bis(4-butoxyphenyl)ethenyl]benzene |
| SMILES | CCCCOc1ccc(C(=Cc2ccc(C=C(c3ccc(OCCCC)cc3)c3ccc(OCCCC)cc3)cc2)c2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C50H58O4/c1-5-9-33-51-45-25-17-41(18-26-45)49(42-19-27-46(28-20-42)52-34-10-6-2)37-39-13-15-40(16-14-39)38-50(43-21-29-47(30-22-43)53-35-11-7-3)44-23-31-48(32-24-44)54-36-12-8-4/h13-32,37-38H,5-12,33-36H2,1-4H3 |
| InChIKey | DTZAJQCGWMZBCC-UHFFFAOYSA-N |
| XLogP | 13.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.01 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|