C26H30ClNO — CID 53446924
2-[4-(1,2-diphenylethenyl)phenoxy]ethyl-diethylazanium chloride (PubChem CID 53446924) has the molecular formula C26H30ClNO and a molecular weight of 407.99 g/mol. Its IUPAC name is 2-[4-(1,2-diphenylethenyl)phenoxy]ethyl-diethylazanium chloride.
| Compound Name | 2-[4-(1,2-diphenylethenyl)phenoxy]ethyl-diethylazanium chloride |
|---|---|
| PubChem CID | 53446924 |
| Molecular Formula | C26H30ClNO |
| Molecular Weight | 407.99 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-[4-(1,2-diphenylethenyl)phenoxy]ethyl-diethylazanium chloride |
| SMILES | CC[NH+](CC)CCOc1ccc(C(=Cc2ccccc2)c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C26H29NO.ClH/c1-3-27(4-2)19-20-28-25-17-15-24(16-18-25)26(23-13-9-6-10-14-23)21-22-11-7-5-8-12-22;/h5-18,21H,3-4,19-20H2,1-2H3;1H |
| InChIKey | VPQKHXADDASFHZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.99 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|