C49H51NO5 — CID 59739359
3-[4-[2-[4-(N-[4-(4-butoxyphenyl)phenyl]-4-methylanilino)phenyl]-1-[4-(3-hydroxypropoxy)phenyl]ethenyl]phenoxy]propan-1-ol (PubChem CID 59739359) has the molecular formula C49H51NO5 and a molecular weight of 733.95 g/mol. Its IUPAC name is 3-[4-[2-[4-(N-[4-(4-butoxyphenyl)phenyl]-4-methylanilino)phenyl]-1-[4-(3-hydroxypropoxy)phenyl]ethenyl]phenoxy]propan-1-ol.
| Compound Name | 3-[4-[2-[4-(N-[4-(4-butoxyphenyl)phenyl]-4-methylanilino)phenyl]-1-[4-(3-hydroxypropoxy)phenyl]ethenyl]phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 59739359 |
| Molecular Formula | C49H51NO5 |
| Molecular Weight | 733.95 g/mol |
| Exact Mass | 733.38 |
| IUPAC Name | 3-[4-[2-[4-(N-[4-(4-butoxyphenyl)phenyl]-4-methylanilino)phenyl]-1-[4-(3-hydroxypropoxy)phenyl]ethenyl]phenoxy]propan-1-ol |
| SMILES | CCCCOc1ccc(-c2ccc(N(c3ccc(C)cc3)c3ccc(C=C(c4ccc(OCCCO)cc4)c4ccc(OCCCO)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C49H51NO5/c1-3-4-33-53-46-25-13-40(14-26-46)39-11-23-45(24-12-39)50(43-19-7-37(2)8-20-43)44-21-9-38(10-22-44)36-49(41-15-27-47(28-16-41)54-34-5-31-51)42-17-29-48(30-18-42)55-35-6-32-52/h7-30,36,51-52H,3-6,31-35H2,1-2H3 |
| InChIKey | FEHSXWNKHGOYQD-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.95 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|