C13H21ClN2O2 — CID 171376200
(4-iminocyclohexa-2,5-dien-1-ylidene)-[3-(trimethylazaniumyl)propoxy]methanolate;hydrochloride (PubChem CID 171376200) has the molecular formula C13H21ClN2O2 and a molecular weight of 272.78 g/mol. Its IUPAC name is (4-iminocyclohexa-2,5-dien-1-ylidene)-[3-(trimethylazaniumyl)propoxy]methanolate;hydrochloride.
| Compound Name | (4-iminocyclohexa-2,5-dien-1-ylidene)-[3-(trimethylazaniumyl)propoxy]methanolate;hydrochloride |
|---|---|
| PubChem CID | 171376200 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (4-iminocyclohexa-2,5-dien-1-ylidene)-[3-(trimethylazaniumyl)propoxy]methanolate;hydrochloride |
| SMILES | Cl.[H]N=C1C=CC(=C([O-])OCCC[N+](C)(C)C)C=C1 |
| InChI | InChI=1S/C13H20N2O2.ClH/c1-15(2,3)9-4-10-17-13(16)11-5-7-12(14)8-6-11;/h5-8H,4,9-10H2,1-3H3,(H-,14,16);1H |
| InChIKey | ARQBXLBFYVSWCK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|