C19H33IN2O2 — CID 171375898
3-[dibutyl(methyl)azaniumyl]propoxy-(4-iminocyclohexa-2,5-dien-1-ylidene)methanolate;hydroiodide (PubChem CID 171375898) has the molecular formula C19H33IN2O2 and a molecular weight of 448.39 g/mol. Its IUPAC name is 3-[dibutyl(methyl)azaniumyl]propoxy-(4-iminocyclohexa-2,5-dien-1-ylidene)methanolate;hydroiodide.
| Compound Name | 3-[dibutyl(methyl)azaniumyl]propoxy-(4-iminocyclohexa-2,5-dien-1-ylidene)methanolate;hydroiodide |
|---|---|
| PubChem CID | 171375898 |
| Molecular Formula | C19H33IN2O2 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-[dibutyl(methyl)azaniumyl]propoxy-(4-iminocyclohexa-2,5-dien-1-ylidene)methanolate;hydroiodide |
| SMILES | I.[H]N=C1C=CC(=C([O-])OCCC[N+](C)(CCCC)CCCC)C=C1 |
| InChI | InChI=1S/C19H32N2O2.HI/c1-4-6-13-21(3,14-7-5-2)15-8-16-23-19(22)17-9-11-18(20)12-10-17;/h9-12H,4-8,13-16H2,1-3H3,(H-,20,22);1H |
| InChIKey | NGEUXSSSMJHBIG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|