C28H35NO2 — CID 20504800
2,4-bis[4-(2-methylbutan-2-yl)phenoxy]aniline (PubChem CID 20504800) has the molecular formula C28H35NO2 and a molecular weight of 417.59 g/mol. Its IUPAC name is 2,4-bis[4-(2-methylbutan-2-yl)phenoxy]aniline.
| Compound Name | 2,4-bis[4-(2-methylbutan-2-yl)phenoxy]aniline |
|---|---|
| PubChem CID | 20504800 |
| Molecular Formula | C28H35NO2 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | 2,4-bis[4-(2-methylbutan-2-yl)phenoxy]aniline |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(N)c(Oc3ccc(C(C)(C)CC)cc3)c2)cc1 |
| InChI | InChI=1S/C28H35NO2/c1-7-27(3,4)20-9-13-22(14-10-20)30-24-17-18-25(29)26(19-24)31-23-15-11-21(12-16-23)28(5,6)8-2/h9-19H,7-8,29H2,1-6H3 |
| InChIKey | XVSLJFNZJMJVDB-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|