C41H39N3O6 — CID 66649899
4-[4-[1,1-bis[4-(4-amino-3-methoxyphenoxy)phenyl]ethyl]phenoxy]-2-methoxyaniline (PubChem CID 66649899) has the molecular formula C41H39N3O6 and a molecular weight of 669.78 g/mol. Its IUPAC name is 4-[4-[1,1-bis[4-(4-amino-3-methoxyphenoxy)phenyl]ethyl]phenoxy]-2-methoxyaniline.
| Compound Name | 4-[4-[1,1-bis[4-(4-amino-3-methoxyphenoxy)phenyl]ethyl]phenoxy]-2-methoxyaniline |
|---|---|
| PubChem CID | 66649899 |
| Molecular Formula | C41H39N3O6 |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.28 |
| IUPAC Name | 4-[4-[1,1-bis[4-(4-amino-3-methoxyphenoxy)phenyl]ethyl]phenoxy]-2-methoxyaniline |
| SMILES | COc1cc(Oc2ccc(C(C)(c3ccc(Oc4ccc(N)c(OC)c4)cc3)c3ccc(Oc4ccc(N)c(OC)c4)cc3)cc2)ccc1N |
| InChI | InChI=1S/C41H39N3O6/c1-41(26-5-11-29(12-6-26)48-32-17-20-35(42)38(23-32)45-2,27-7-13-30(14-8-27)49-33-18-21-36(43)39(24-33)46-3)28-9-15-31(16-10-28)50-34-19-22-37(44)40(25-34)47-4/h5-25H,42-44H2,1-4H3 |
| InChIKey | VLEFAPISHRHLOG-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 133.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|