C22H43N — CID 176698481
3-tert-butyl-5-(2,4,4-trimethylpentan-2-yl)aniline;ethane (PubChem CID 176698481) has the molecular formula C22H43N and a molecular weight of 321.59 g/mol. Its IUPAC name is 3-tert-butyl-5-(2,4,4-trimethylpentan-2-yl)aniline;ethane.
| Compound Name | 3-tert-butyl-5-(2,4,4-trimethylpentan-2-yl)aniline;ethane |
|---|---|
| PubChem CID | 176698481 |
| Molecular Formula | C22H43N |
| Molecular Weight | 321.59 g/mol |
| Exact Mass | 321.34 |
| IUPAC Name | 3-tert-butyl-5-(2,4,4-trimethylpentan-2-yl)aniline;ethane |
| SMILES | CC.CC.CC(C)(C)CC(C)(C)c1cc(N)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H31N.2C2H6/c1-16(2,3)12-18(7,8)14-9-13(17(4,5)6)10-15(19)11-14;2*1-2/h9-11H,12,19H2,1-8H3;2*1-2H3 |
| InChIKey | LMGKUESMVSPZJI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.59 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|