C23H44N2 — CID 176698479
2,6-bis(2,4,4-trimethylpentan-2-yl)pyridin-4-amine;ethane (PubChem CID 176698479) has the molecular formula C23H44N2 and a molecular weight of 348.62 g/mol. Its IUPAC name is 2,6-bis(2,4,4-trimethylpentan-2-yl)pyridin-4-amine;ethane.
| Compound Name | 2,6-bis(2,4,4-trimethylpentan-2-yl)pyridin-4-amine;ethane |
|---|---|
| PubChem CID | 176698479 |
| Molecular Formula | C23H44N2 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 348.35 |
| IUPAC Name | 2,6-bis(2,4,4-trimethylpentan-2-yl)pyridin-4-amine;ethane |
| SMILES | CC.CC(C)(C)CC(C)(C)c1cc(N)cc(C(C)(C)CC(C)(C)C)n1 |
| InChI | InChI=1S/C21H38N2.C2H6/c1-18(2,3)13-20(7,8)16-11-15(22)12-17(23-16)21(9,10)14-19(4,5)6;1-2/h11-12H,13-14H2,1-10H3,(H2,22,23);1-2H3 |
| InChIKey | YCBLOALWZJBBGB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |