C18H29N — CID 70694935
3-[(Z)-dec-1-enyl]-2,4,6-trimethylpyridine (PubChem CID 70694935) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 3-[(Z)-dec-1-enyl]-2,4,6-trimethylpyridine.
| Compound Name | 3-[(Z)-dec-1-enyl]-2,4,6-trimethylpyridine |
|---|---|
| PubChem CID | 70694935 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 3-[(Z)-dec-1-enyl]-2,4,6-trimethylpyridine |
| SMILES | CCCCCCCC/C=C\c1c(C)cc(C)nc1C |
| InChI | InChI=1S/C18H29N/c1-5-6-7-8-9-10-11-12-13-18-15(2)14-16(3)19-17(18)4/h12-14H,5-11H2,1-4H3/b13-12- |
| InChIKey | BQXJCXDOLDLMQE-SEYXRHQNSA-N |
| XLogP | 5.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|